C21H29BF3NO5 — CID 20806729
tert-butyl N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-N-(2,2,2-trifluoroacetyl)carbamate (PubChem CID 20806729) has the molecular formula C21H29BF3NO5 and a molecular weight of 443.27 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-N-(2,2,2-trifluoroacetyl)carbamate.
| Compound Name | tert-butyl N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-N-(2,2,2-trifluoroacetyl)carbamate |
|---|---|
| PubChem CID | 20806729 |
| Molecular Formula | C21H29BF3NO5 |
| Molecular Weight | 443.27 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | tert-butyl N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-N-(2,2,2-trifluoroacetyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCc1ccc(B2OC(C)(C)C(C)(C)O2)cc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C21H29BF3NO5/c1-18(2,3)29-17(28)26(16(27)21(23,24)25)13-12-14-8-10-15(11-9-14)22-30-19(4,5)20(6,7)31-22/h8-11H,12-13H2,1-7H3 |
| InChIKey | ADVWPFGWYGFETG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.27 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|