C25H45BN2O5 — CID 144630370
tert-butyl N-methyl-N-[2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]ethyl]carbamate;ethane (PubChem CID 144630370) has the molecular formula C25H45BN2O5 and a molecular weight of 464.46 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]ethyl]carbamate;ethane.
| Compound Name | tert-butyl N-methyl-N-[2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]ethyl]carbamate;ethane |
|---|---|
| PubChem CID | 144630370 |
| Molecular Formula | C25H45BN2O5 |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.34 |
| IUPAC Name | tert-butyl N-methyl-N-[2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]ethyl]carbamate;ethane |
| SMILES | CC.CC.CN(CCNC(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H33BN2O5.2C2H6/c1-19(2,3)27-18(26)24(8)14-13-23-17(25)15-9-11-16(12-10-15)22-28-20(4,5)21(6,7)29-22;2*1-2/h9-12H,13-14H2,1-8H3,(H,23,25);2*1-2H3 |
| InChIKey | XQXJVAOTDHBFEN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|