C19H35BN4O4 — CID 162438447
tert-butyl N-methyl-N-[2-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethylamino]ethyl]carbamate (PubChem CID 162438447) has the molecular formula C19H35BN4O4 and a molecular weight of 394.33 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[2-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 162438447 |
| Molecular Formula | C19H35BN4O4 |
| Molecular Weight | 394.33 g/mol |
| Exact Mass | 394.28 |
| IUPAC Name | tert-butyl N-methyl-N-[2-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethylamino]ethyl]carbamate |
| SMILES | CN(CCNCCn1nccc1B1OC(C)(C)C(C)(C)O1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H35BN4O4/c1-17(2,3)26-16(25)23(8)13-11-21-12-14-24-15(9-10-22-24)20-27-18(4,5)19(6,7)28-20/h9-10,21H,11-14H2,1-8H3 |
| InChIKey | SIZKYDRTOWDSBG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|