C30H42BNO5 — CID 172766473
tert-butyl (2S)-2-[(4-tert-butylbenzoyl)amino]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate (PubChem CID 172766473) has the molecular formula C30H42BNO5 and a molecular weight of 507.48 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(4-tert-butylbenzoyl)amino]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate.
| Compound Name | tert-butyl (2S)-2-[(4-tert-butylbenzoyl)amino]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 172766473 |
| Molecular Formula | C30H42BNO5 |
| Molecular Weight | 507.48 g/mol |
| Exact Mass | 507.32 |
| IUPAC Name | tert-butyl (2S)-2-[(4-tert-butylbenzoyl)amino]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate |
| SMILES | CC(C)(C)OC(=O)[C@@](C)(NC(=O)c1ccc(C(C)(C)C)cc1)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C30H42BNO5/c1-26(2,3)21-14-12-20(13-15-21)24(33)32-30(11,25(34)35-27(4,5)6)22-16-18-23(19-17-22)31-36-28(7,8)29(9,10)37-31/h12-19H,1-11H3,(H,32,33)/t30-/m0/s1 |
| InChIKey | MJMJGHDQCVOVRI-PMERELPUSA-N |
| XLogP | 5.27 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|