C28H38BNO5 — CID 172805135
methyl (2S)-3-[(4-tert-butylbenzoyl)amino]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanoate (PubChem CID 172805135) has the molecular formula C28H38BNO5 and a molecular weight of 479.43 g/mol. Its IUPAC name is methyl (2S)-3-[(4-tert-butylbenzoyl)amino]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanoate.
| Compound Name | methyl (2S)-3-[(4-tert-butylbenzoyl)amino]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanoate |
|---|---|
| PubChem CID | 172805135 |
| Molecular Formula | C28H38BNO5 |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | methyl (2S)-3-[(4-tert-butylbenzoyl)amino]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanoate |
| SMILES | COC(=O)[C@@H](c1ccc(B2OC(C)(C)C(C)(C)O2)cc1)C(C)NC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H38BNO5/c1-18(30-24(31)20-10-14-21(15-11-20)26(2,3)4)23(25(32)33-9)19-12-16-22(17-13-19)29-34-27(5,6)28(7,8)35-29/h10-18,23H,1-9H3,(H,30,31)/t18?,23-/m1/s1 |
| InChIKey | RKENPQNXEDUGOU-WBPHRXDCSA-N |
| XLogP | 4.36 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|