C20H25BN2O3 — CID 170903439
N-[(1S)-1-pyridin-2-ylethyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (PubChem CID 170903439) has the molecular formula C20H25BN2O3 and a molecular weight of 352.24 g/mol. Its IUPAC name is N-[(1S)-1-pyridin-2-ylethyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide.
| Compound Name | N-[(1S)-1-pyridin-2-ylethyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
|---|---|
| PubChem CID | 170903439 |
| Molecular Formula | C20H25BN2O3 |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | N-[(1S)-1-pyridin-2-ylethyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| SMILES | C[C@H](NC(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1)c1ccccn1 |
| InChI | InChI=1S/C20H25BN2O3/c1-14(17-8-6-7-13-22-17)23-18(24)15-9-11-16(12-10-15)21-25-19(2,3)20(4,5)26-21/h6-14H,1-5H3,(H,23,24)/t14-/m0/s1 |
| InChIKey | YMJBRIPVQNAJPA-AWEZNQCLSA-N |
| XLogP | 2.87 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|