C18H22N2O — CID 35939821
4-tert-butyl-N-[(1S)-1-pyridin-2-ylethyl]benzamide (PubChem CID 35939821) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 4-tert-butyl-N-[(1S)-1-pyridin-2-ylethyl]benzamide.
| Compound Name | 4-tert-butyl-N-[(1S)-1-pyridin-2-ylethyl]benzamide |
|---|---|
| PubChem CID | 35939821 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 4-tert-butyl-N-[(1S)-1-pyridin-2-ylethyl]benzamide |
| SMILES | C[C@H](NC(=O)c1ccc(C(C)(C)C)cc1)c1ccccn1 |
| InChI | InChI=1S/C18H22N2O/c1-13(16-7-5-6-12-19-16)20-17(21)14-8-10-15(11-9-14)18(2,3)4/h5-13H,1-4H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | HDYCKLOKTKQXHR-ZDUSSCGKSA-N |
| XLogP | 3.87 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |