C19H26BNO7 — CID 123357052
dimethyl 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]butanedioate (PubChem CID 123357052) has the molecular formula C19H26BNO7 and a molecular weight of 391.23 g/mol. Its IUPAC name is dimethyl 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]butanedioate.
| Compound Name | dimethyl 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]butanedioate |
|---|---|
| PubChem CID | 123357052 |
| Molecular Formula | C19H26BNO7 |
| Molecular Weight | 391.23 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | dimethyl 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]butanedioate |
| SMILES | COC(=O)CC(NC(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1)C(=O)OC |
| InChI | InChI=1S/C19H26BNO7/c1-18(2)19(3,4)28-20(27-18)13-9-7-12(8-10-13)16(23)21-14(17(24)26-6)11-15(22)25-5/h7-10,14H,11H2,1-6H3,(H,21,23) |
| InChIKey | GBOCOOORDIHAHZ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.23 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|