C13H15NO6 — CID 56977908
4-[(1,4-dimethoxy-1,4-dioxobutan-2-yl)amino]benzoic acid (PubChem CID 56977908) has the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. Its IUPAC name is 4-[(1,4-dimethoxy-1,4-dioxobutan-2-yl)amino]benzoic acid.
| Compound Name | 4-[(1,4-dimethoxy-1,4-dioxobutan-2-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 56977908 |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 4-[(1,4-dimethoxy-1,4-dioxobutan-2-yl)amino]benzoic acid |
| SMILES | COC(=O)CC(Nc1ccc(C(=O)O)cc1)C(=O)OC |
| InChI | InChI=1S/C13H15NO6/c1-19-11(15)7-10(13(18)20-2)14-9-5-3-8(4-6-9)12(16)17/h3-6,10,14H,7H2,1-2H3,(H,16,17) |
| InChIKey | CMRNUIQZLDGYJR-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |