C10H14N2O2 — CID 103387752
4-(1-aminopropan-2-ylamino)benzoic acid (PubChem CID 103387752) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 4-(1-aminopropan-2-ylamino)benzoic acid.
| Compound Name | 4-(1-aminopropan-2-ylamino)benzoic acid |
|---|---|
| PubChem CID | 103387752 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 4-(1-aminopropan-2-ylamino)benzoic acid |
| SMILES | CC(CN)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C10H14N2O2/c1-7(6-11)12-9-4-2-8(3-5-9)10(13)14/h2-5,7,12H,6,11H2,1H3,(H,13,14) |
| InChIKey | VJUVPDHLKQYWTR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |