C10H16N2 — CID 12693167
2-N-(4-methylphenyl)propane-1,2-diamine (PubChem CID 12693167) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 2-N-(4-methylphenyl)propane-1,2-diamine.
| Compound Name | 2-N-(4-methylphenyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 12693167 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 2-N-(4-methylphenyl)propane-1,2-diamine |
| SMILES | Cc1ccc(NC(C)CN)cc1 |
| InChI | InChI=1S/C10H16N2/c1-8-3-5-10(6-4-8)12-9(2)7-11/h3-6,9,12H,7,11H2,1-2H3 |
| InChIKey | UWNXTNZKAFFQMV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |