C18H24O10 — CID 174878571
dimethyl 2-(1,4-dihydroxybutyl)butanedioate;terephthalic acid (PubChem CID 174878571) has the molecular formula C18H24O10 and a molecular weight of 400.38 g/mol. Its IUPAC name is dimethyl 2-(1,4-dihydroxybutyl)butanedioate;terephthalic acid.
| Compound Name | dimethyl 2-(1,4-dihydroxybutyl)butanedioate;terephthalic acid |
|---|---|
| PubChem CID | 174878571 |
| Molecular Formula | C18H24O10 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | dimethyl 2-(1,4-dihydroxybutyl)butanedioate;terephthalic acid |
| SMILES | COC(=O)CC(C(=O)OC)C(O)CCCO.O=C(O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C10H18O6.C8H6O4/c1-15-9(13)6-7(10(14)16-2)8(12)4-3-5-11;9-7(10)5-1-2-6(4-3-5)8(11)12/h7-8,11-12H,3-6H2,1-2H3;1-4H,(H,9,10)(H,11,12) |
| InChIKey | SUVARJNHUANDES-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |