C15H15NO5 — CID 102006236
dimethyl 2-[(4-ethynylbenzoyl)amino]butanedioate (PubChem CID 102006236) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is dimethyl 2-[(4-ethynylbenzoyl)amino]butanedioate.
| Compound Name | dimethyl 2-[(4-ethynylbenzoyl)amino]butanedioate |
|---|---|
| PubChem CID | 102006236 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | dimethyl 2-[(4-ethynylbenzoyl)amino]butanedioate |
| SMILES | C#Cc1ccc(C(=O)NC(CC(=O)OC)C(=O)OC)cc1 |
| InChI | InChI=1S/C15H15NO5/c1-4-10-5-7-11(8-6-10)14(18)16-12(15(19)21-3)9-13(17)20-2/h1,5-8,12H,9H2,2-3H3,(H,16,18) |
| InChIKey | LWOXKSWHZOGJNR-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|