C13H14BrNO6 — CID 118225690
dimethyl 2-[(3-bromo-5-hydroxybenzoyl)amino]butanedioate (PubChem CID 118225690) has the molecular formula C13H14BrNO6 and a molecular weight of 360.16 g/mol. Its IUPAC name is dimethyl 2-[(3-bromo-5-hydroxybenzoyl)amino]butanedioate.
| Compound Name | dimethyl 2-[(3-bromo-5-hydroxybenzoyl)amino]butanedioate |
|---|---|
| PubChem CID | 118225690 |
| Molecular Formula | C13H14BrNO6 |
| Molecular Weight | 360.16 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | dimethyl 2-[(3-bromo-5-hydroxybenzoyl)amino]butanedioate |
| SMILES | COC(=O)CC(NC(=O)c1cc(O)cc(Br)c1)C(=O)OC |
| InChI | InChI=1S/C13H14BrNO6/c1-20-11(17)6-10(13(19)21-2)15-12(18)7-3-8(14)5-9(16)4-7/h3-5,10,16H,6H2,1-2H3,(H,15,18) |
| InChIKey | AVEWVPNGHMDTPQ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.16 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |