C15H19NO6 — CID 141045738
4-[[(2R)-1-methoxy-3-[(2-methylpropan-2-yl)oxy]-1,3-dioxopropan-2-yl]amino]benzoic acid (PubChem CID 141045738) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is 4-[[(2R)-1-methoxy-3-[(2-methylpropan-2-yl)oxy]-1,3-dioxopropan-2-yl]amino]benzoic acid.
| Compound Name | 4-[[(2R)-1-methoxy-3-[(2-methylpropan-2-yl)oxy]-1,3-dioxopropan-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 141045738 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 4-[[(2R)-1-methoxy-3-[(2-methylpropan-2-yl)oxy]-1,3-dioxopropan-2-yl]amino]benzoic acid |
| SMILES | COC(=O)[C@@H](Nc1ccc(C(=O)O)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H19NO6/c1-15(2,3)22-14(20)11(13(19)21-4)16-10-7-5-9(6-8-10)12(17)18/h5-8,11,16H,1-4H3,(H,17,18)/t11-/m1/s1 |
| InChIKey | UVEVTCRVYAYECI-LLVKDONJSA-N |
| XLogP | 1.68 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|