About tert-butyl 2-(4-aminoanilino)propanoate;dihydrochloride
tert-butyl 2-(4-aminoanilino)propanoate;dihydrochloride (PubChem CID 69204508) has the molecular formula C13H22Cl2N2O2
and a molecular weight of 309.24 g/mol. Its IUPAC name is tert-butyl 2-(4-aminoanilino)propanoate;dihydrochloride.
Molecular Properties
| Compound Name | tert-butyl 2-(4-aminoanilino)propanoate;dihydrochloride |
| PubChem CID | 69204508 |
| Molecular Formula | C13H22Cl2N2O2 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | tert-butyl 2-(4-aminoanilino)propanoate;dihydrochloride |
| SMILES | CC(Nc1ccc(N)cc1)C(=O)OC(C)(C)C.Cl.Cl |
| InChI | InChI=1S/C13H20N2O2.2ClH/c1-9(12(16)17-13(2,3)4)15-11-7-5-10(14)6-8-11;;/h5-9,15H,14H2,1-4H3;2*1H |
| InChIKey | PAPPZXAYPYLMFG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-(4-aminoanilino)propanoate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(4-aminoanilino)propanoate;dihydrochloride?
The IUPAC name of tert-butyl 2-(4-aminoanilino)propanoate;dihydrochloride (CID 69204508) is tert-butyl 2-(4-aminoanilino)propanoate;dihydrochloride.
What is the SMILES notation for tert-butyl 2-(4-aminoanilino)propanoate;dihydrochloride?
The canonical SMILES for tert-butyl 2-(4-aminoanilino)propanoate;dihydrochloride is CC(Nc1ccc(N)cc1)C(=O)OC(C)(C)C.Cl.Cl.
What is the InChIKey of tert-butyl 2-(4-aminoanilino)propanoate;dihydrochloride?
The InChIKey is PAPPZXAYPYLMFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2.2ClH/c1-9(12(16)17-13(2,3)4)15-11-7-5-10(14)6-8-11;;/h5-9,15H,14H2,1-4H3;2*1H.
What are the key properties of tert-butyl 2-(4-aminoanilino)propanoate;dihydrochloride?
tert-butyl 2-(4-aminoanilino)propanoate;dihydrochloride has a molecular weight of 309.24 g/mol, XLogP of 3.25, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(4-aminoanilino)propanoate;dihydrochloride is sourced from PubChem (CID 69204508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).