C15H21N3O6 — CID 57092789
2-[2-[(2S)-2-(4-aminoanilino)propanoyl]oxyethyl-(carboxymethyl)amino]acetic acid (PubChem CID 57092789) has the molecular formula C15H21N3O6 and a molecular weight of 339.35 g/mol. Its IUPAC name is 2-[2-[(2S)-2-(4-aminoanilino)propanoyl]oxyethyl-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[2-[(2S)-2-(4-aminoanilino)propanoyl]oxyethyl-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 57092789 |
| Molecular Formula | C15H21N3O6 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 2-[2-[(2S)-2-(4-aminoanilino)propanoyl]oxyethyl-(carboxymethyl)amino]acetic acid |
| SMILES | C[C@H](Nc1ccc(N)cc1)C(=O)OCCN(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C15H21N3O6/c1-10(17-12-4-2-11(16)3-5-12)15(23)24-7-6-18(8-13(19)20)9-14(21)22/h2-5,10,17H,6-9,16H2,1H3,(H,19,20)(H,21,22)/t10-/m0/s1 |
| InChIKey | XYDHKPLIBGEFMQ-JTQLQIEISA-N |
| XLogP | 0.08 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|