C22H28BNO3 — CID 175122328
N-(2-phenylpropan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (PubChem CID 175122328) has the molecular formula C22H28BNO3 and a molecular weight of 365.28 g/mol. Its IUPAC name is N-(2-phenylpropan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide.
| Compound Name | N-(2-phenylpropan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
|---|---|
| PubChem CID | 175122328 |
| Molecular Formula | C22H28BNO3 |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | N-(2-phenylpropan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| SMILES | CC(C)(NC(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H28BNO3/c1-20(2,17-10-8-7-9-11-17)24-19(25)16-12-14-18(15-13-16)23-26-21(3,4)22(5,6)27-23/h7-15H,1-6H3,(H,24,25) |
| InChIKey | TXRYYNQYAVMQDQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|