C19H29BN2O2 — CID 131314274
N,N-dimethyl-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]propan-1-amine (PubChem CID 131314274) has the molecular formula C19H29BN2O2 and a molecular weight of 328.27 g/mol. Its IUPAC name is N,N-dimethyl-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 131314274 |
| Molecular Formula | C19H29BN2O2 |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | N,N-dimethyl-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]propan-1-amine |
| SMILES | CN(C)CCCn1ccc2cc(B3OC(C)(C)C(C)(C)O3)ccc21 |
| InChI | InChI=1S/C19H29BN2O2/c1-18(2)19(3,4)24-20(23-18)16-8-9-17-15(14-16)10-13-22(17)12-7-11-21(5)6/h8-10,13-14H,7,11-12H2,1-6H3 |
| InChIKey | KUJNPJOWQCWDIX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|