C14H20ClN3 — CID 55256324
N-[2-(5-chloroindol-1-yl)ethyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 55256324) has the molecular formula C14H20ClN3 and a molecular weight of 265.79 g/mol. Its IUPAC name is N-[2-(5-chloroindol-1-yl)ethyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[2-(5-chloroindol-1-yl)ethyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 55256324 |
| Molecular Formula | C14H20ClN3 |
| Molecular Weight | 265.79 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | N-[2-(5-chloroindol-1-yl)ethyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNCCn1ccc2cc(Cl)ccc21 |
| InChI | InChI=1S/C14H20ClN3/c1-17(2)9-6-16-7-10-18-8-5-12-11-13(15)3-4-14(12)18/h3-5,8,11,16H,6-7,9-10H2,1-2H3 |
| InChIKey | NTSZOIKBINPLKW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.79 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|