C12H13ClN2O — CID 116623166
2-(5-chloroindol-1-yl)-N,N-dimethylacetamide (PubChem CID 116623166) has the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. Its IUPAC name is 2-(5-chloroindol-1-yl)-N,N-dimethylacetamide.
| Compound Name | 2-(5-chloroindol-1-yl)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 116623166 |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 2-(5-chloroindol-1-yl)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)Cn1ccc2cc(Cl)ccc21 |
| InChI | InChI=1S/C12H13ClN2O/c1-14(2)12(16)8-15-6-5-9-7-10(13)3-4-11(9)15/h3-7H,8H2,1-2H3 |
| InChIKey | XTVAQKVYQVGKFI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |