C12H15N3O — CID 43165387
2-(5-aminoindol-1-yl)-N,N-dimethylacetamide (PubChem CID 43165387) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-(5-aminoindol-1-yl)-N,N-dimethylacetamide.
| Compound Name | 2-(5-aminoindol-1-yl)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 43165387 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 2-(5-aminoindol-1-yl)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)Cn1ccc2cc(N)ccc21 |
| InChI | InChI=1S/C12H15N3O/c1-14(2)12(16)8-15-6-5-9-7-10(13)3-4-11(9)15/h3-7H,8,13H2,1-2H3 |
| InChIKey | DTDDBXVRHQWLJH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk_indol_A(1)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|