C13H16BNO2 — CID 132502151
5-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)-1-methylindole (PubChem CID 132502151) has the molecular formula C13H16BNO2 and a molecular weight of 229.09 g/mol. Its IUPAC name is 5-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)-1-methylindole.
| Compound Name | 5-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)-1-methylindole |
|---|---|
| PubChem CID | 132502151 |
| Molecular Formula | C13H16BNO2 |
| Molecular Weight | 229.09 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 5-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)-1-methylindole |
| SMILES | Cn1ccc2cc(B3OCC(C)(C)O3)ccc21 |
| InChI | InChI=1S/C13H16BNO2/c1-13(2)9-16-14(17-13)11-4-5-12-10(8-11)6-7-15(12)3/h4-8H,9H2,1-3H3 |
| InChIKey | YDVKYDKCDSVCSV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.09 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|