C12H12N2 — CID 170295030
1,7-dimethylpyrrolo[3,2-f]indole (PubChem CID 170295030) has the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 1,7-dimethylpyrrolo[3,2-f]indole.
| Compound Name | 1,7-dimethylpyrrolo[3,2-f]indole |
|---|---|
| PubChem CID | 170295030 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 1,7-dimethylpyrrolo[3,2-f]indole |
| SMILES | Cn1ccc2cc3ccn(C)c3cc21 |
| InChI | InChI=1S/C12H12N2/c1-13-5-3-9-7-10-4-6-14(2)12(10)8-11(9)13/h3-8H,1-2H3 |
| InChIKey | NGGYRTXJBLMBRB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |