C20H32BNO2Si — CID 56973095
tert-butyl-dimethyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]silane (PubChem CID 56973095) has the molecular formula C20H32BNO2Si and a molecular weight of 357.38 g/mol. Its IUPAC name is tert-butyl-dimethyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]silane.
| Compound Name | tert-butyl-dimethyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]silane |
|---|---|
| PubChem CID | 56973095 |
| Molecular Formula | C20H32BNO2Si |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | tert-butyl-dimethyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]silane |
| SMILES | CC1(C)OB(c2ccc3c(ccn3[Si](C)(C)C(C)(C)C)c2)OC1(C)C |
| InChI | InChI=1S/C20H32BNO2Si/c1-18(2,3)25(8,9)22-13-12-15-14-16(10-11-17(15)22)21-23-19(4,5)20(6,7)24-21/h10-14H,1-9H3 |
| InChIKey | OPSNXUGQPVWOTJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|