C19H20BFN2O3 — CID 163234419
2-fluoro-5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]phenol (PubChem CID 163234419) has the molecular formula C19H20BFN2O3 and a molecular weight of 354.19 g/mol. Its IUPAC name is 2-fluoro-5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]phenol.
| Compound Name | 2-fluoro-5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]phenol |
|---|---|
| PubChem CID | 163234419 |
| Molecular Formula | C19H20BFN2O3 |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2-fluoro-5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]phenol |
| SMILES | CC1(C)OB(c2ccc3c(cnn3-c3ccc(F)c(O)c3)c2)OC1(C)C |
| InChI | InChI=1S/C19H20BFN2O3/c1-18(2)19(3,4)26-20(25-18)13-5-8-16-12(9-13)11-22-23(16)14-6-7-15(21)17(24)10-14/h5-11,24H,1-4H3 |
| InChIKey | NCKANXRCPVEJGF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|