C20H20FN3O2 — CID 163234431
1-[4-[1-(4-fluoro-3-hydroxyphenyl)indazol-5-yl]piperidin-1-yl]ethanone (PubChem CID 163234431) has the molecular formula C20H20FN3O2 and a molecular weight of 353.40 g/mol. Its IUPAC name is 1-[4-[1-(4-fluoro-3-hydroxyphenyl)indazol-5-yl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[1-(4-fluoro-3-hydroxyphenyl)indazol-5-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 163234431 |
| Molecular Formula | C20H20FN3O2 |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 1-[4-[1-(4-fluoro-3-hydroxyphenyl)indazol-5-yl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(c2ccc3c(cnn3-c3ccc(F)c(O)c3)c2)CC1 |
| InChI | InChI=1S/C20H20FN3O2/c1-13(25)23-8-6-14(7-9-23)15-2-5-19-16(10-15)12-22-24(19)17-3-4-18(21)20(26)11-17/h2-5,10-12,14,26H,6-9H2,1H3 |
| InChIKey | FOXFZYSAUJKUIX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |