C23H33FN2O2 — CID 156864422
N-[3-[4-(3-tert-butyl-4-fluorophenyl)piperidine-1-carbonyl]cyclobutyl]propanamide (PubChem CID 156864422) has the molecular formula C23H33FN2O2 and a molecular weight of 388.53 g/mol. Its IUPAC name is N-[3-[4-(3-tert-butyl-4-fluorophenyl)piperidine-1-carbonyl]cyclobutyl]propanamide.
| Compound Name | N-[3-[4-(3-tert-butyl-4-fluorophenyl)piperidine-1-carbonyl]cyclobutyl]propanamide |
|---|---|
| PubChem CID | 156864422 |
| Molecular Formula | C23H33FN2O2 |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | N-[3-[4-(3-tert-butyl-4-fluorophenyl)piperidine-1-carbonyl]cyclobutyl]propanamide |
| SMILES | CCC(=O)NC1CC(C(=O)N2CCC(c3ccc(F)c(C(C)(C)C)c3)CC2)C1 |
| InChI | InChI=1S/C23H33FN2O2/c1-5-21(27)25-18-12-17(13-18)22(28)26-10-8-15(9-11-26)16-6-7-20(24)19(14-16)23(2,3)4/h6-7,14-15,17-18H,5,8-13H2,1-4H3,(H,25,27) |
| InChIKey | JSGVKGGAXJAZKF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |