C23H36N2O2 — CID 167469749
tert-butylbenzene;N-[3-(3-methylpyrrolidine-1-carbonyl)cyclobutyl]propanamide (PubChem CID 167469749) has the molecular formula C23H36N2O2 and a molecular weight of 372.55 g/mol. Its IUPAC name is tert-butylbenzene;N-[3-(3-methylpyrrolidine-1-carbonyl)cyclobutyl]propanamide.
| Compound Name | tert-butylbenzene;N-[3-(3-methylpyrrolidine-1-carbonyl)cyclobutyl]propanamide |
|---|---|
| PubChem CID | 167469749 |
| Molecular Formula | C23H36N2O2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | tert-butylbenzene;N-[3-(3-methylpyrrolidine-1-carbonyl)cyclobutyl]propanamide |
| SMILES | CC(C)(C)c1ccccc1.CCC(=O)NC1CC(C(=O)N2CCC(C)C2)C1 |
| InChI | InChI=1S/C13H22N2O2.C10H14/c1-3-12(16)14-11-6-10(7-11)13(17)15-5-4-9(2)8-15;1-10(2,3)9-7-5-4-6-8-9/h9-11H,3-8H2,1-2H3,(H,14,16);4-8H,1-3H3 |
| InChIKey | OMRWWKIJSPEHCV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |