About tert-butylbenzene;methyl N-[3-(piperidine-1-carbonyl)cyclobutyl]carbamate
tert-butylbenzene;methyl N-[3-(piperidine-1-carbonyl)cyclobutyl]carbamate (PubChem CID 156864323) has the molecular formula C22H34N2O3
and a molecular weight of 374.52 g/mol. Its IUPAC name is tert-butylbenzene;methyl N-[3-(piperidine-1-carbonyl)cyclobutyl]carbamate.
Molecular Properties
| Compound Name | tert-butylbenzene;methyl N-[3-(piperidine-1-carbonyl)cyclobutyl]carbamate |
| PubChem CID | 156864323 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | tert-butylbenzene;methyl N-[3-(piperidine-1-carbonyl)cyclobutyl]carbamate |
| SMILES | CC(C)(C)c1ccccc1.COC(=O)NC1CC(C(=O)N2CCCCC2)C1 |
| InChI | InChI=1S/C12H20N2O3.C10H14/c1-17-12(16)13-10-7-9(8-10)11(15)14-5-3-2-4-6-14;1-10(2,3)9-7-5-4-6-8-9/h9-10H,2-8H2,1H3,(H,13,16);4-8H,1-3H3 |
| InChIKey | WVLOYFSEDZNHKF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butylbenzene;methyl N-[3-(piperidine-1-carbonyl)cyclobutyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylbenzene;methyl N-[3-(piperidine-1-carbonyl)cyclobutyl]carbamate?
The IUPAC name of tert-butylbenzene;methyl N-[3-(piperidine-1-carbonyl)cyclobutyl]carbamate (CID 156864323) is tert-butylbenzene;methyl N-[3-(piperidine-1-carbonyl)cyclobutyl]carbamate.
What is the SMILES notation for tert-butylbenzene;methyl N-[3-(piperidine-1-carbonyl)cyclobutyl]carbamate?
The canonical SMILES for tert-butylbenzene;methyl N-[3-(piperidine-1-carbonyl)cyclobutyl]carbamate is CC(C)(C)c1ccccc1.COC(=O)NC1CC(C(=O)N2CCCCC2)C1.
What is the InChIKey of tert-butylbenzene;methyl N-[3-(piperidine-1-carbonyl)cyclobutyl]carbamate?
The InChIKey is WVLOYFSEDZNHKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O3.C10H14/c1-17-12(16)13-10-7-9(8-10)11(15)14-5-3-2-4-6-14;1-10(2,3)9-7-5-4-6-8-9/h9-10H,2-8H2,1H3,(H,13,16);4-8H,1-3H3.
What are the key properties of tert-butylbenzene;methyl N-[3-(piperidine-1-carbonyl)cyclobutyl]carbamate?
tert-butylbenzene;methyl N-[3-(piperidine-1-carbonyl)cyclobutyl]carbamate has a molecular weight of 374.52 g/mol, XLogP of 4.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylbenzene;methyl N-[3-(piperidine-1-carbonyl)cyclobutyl]carbamate is sourced from PubChem (CID 156864323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).