C21H29ClN2O3 — CID 156825696
ethane;methyl N-[3-(7-chloro-6-phenyl-3-azabicyclo[4.1.0]heptane-3-carbonyl)cyclobutyl]carbamate (PubChem CID 156825696) has the molecular formula C21H29ClN2O3 and a molecular weight of 392.93 g/mol. Its IUPAC name is ethane;methyl N-[3-(7-chloro-6-phenyl-3-azabicyclo[4.1.0]heptane-3-carbonyl)cyclobutyl]carbamate.
| Compound Name | ethane;methyl N-[3-(7-chloro-6-phenyl-3-azabicyclo[4.1.0]heptane-3-carbonyl)cyclobutyl]carbamate |
|---|---|
| PubChem CID | 156825696 |
| Molecular Formula | C21H29ClN2O3 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | ethane;methyl N-[3-(7-chloro-6-phenyl-3-azabicyclo[4.1.0]heptane-3-carbonyl)cyclobutyl]carbamate |
| SMILES | CC.COC(=O)NC1CC(C(=O)N2CCC3(c4ccccc4)C(Cl)C3C2)C1 |
| InChI | InChI=1S/C19H23ClN2O3.C2H6/c1-25-18(24)21-14-9-12(10-14)17(23)22-8-7-19(15(11-22)16(19)20)13-5-3-2-4-6-13;1-2/h2-6,12,14-16H,7-11H2,1H3,(H,21,24);1-2H3 |
| InChIKey | KXJFLVLIZAWHRB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|