C20H34N2O3 — CID 90785956
tert-butyl N-methylcarbamate;1-piperidin-1-ylethanone;toluene (PubChem CID 90785956) has the molecular formula C20H34N2O3 and a molecular weight of 350.50 g/mol. Its IUPAC name is tert-butyl N-methylcarbamate;1-piperidin-1-ylethanone;toluene.
| Compound Name | tert-butyl N-methylcarbamate;1-piperidin-1-ylethanone;toluene |
|---|---|
| PubChem CID | 90785956 |
| Molecular Formula | C20H34N2O3 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | tert-butyl N-methylcarbamate;1-piperidin-1-ylethanone;toluene |
| SMILES | CC(=O)N1CCCCC1.CNC(=O)OC(C)(C)C.Cc1ccccc1 |
| InChI | InChI=1S/C7H13NO.C7H8.C6H13NO2/c1-7(9)8-5-3-2-4-6-8;1-7-5-3-2-4-6-7;1-6(2,3)9-5(8)7-4/h2-6H2,1H3;2-6H,1H3;1-4H3,(H,7,8) |
| InChIKey | LECWICFVIIDPNX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |