C14H24N2O3 — CID 178120124
tert-butyl N-methylcarbamate;1-pyrrolidin-1-ylbut-2-yn-1-one (PubChem CID 178120124) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is tert-butyl N-methylcarbamate;1-pyrrolidin-1-ylbut-2-yn-1-one.
| Compound Name | tert-butyl N-methylcarbamate;1-pyrrolidin-1-ylbut-2-yn-1-one |
|---|---|
| PubChem CID | 178120124 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | tert-butyl N-methylcarbamate;1-pyrrolidin-1-ylbut-2-yn-1-one |
| SMILES | CC#CC(=O)N1CCCC1.CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C8H11NO.C6H13NO2/c1-2-5-8(10)9-6-3-4-7-9;1-6(2,3)9-5(8)7-4/h3-4,6-7H2,1H3;1-4H3,(H,7,8) |
| InChIKey | NOSDHGAJIXCIQL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|