About tert-butyl N-methylcarbamate;1-(3-fluoropyrrolidin-1-yl)but-2-yn-1-one
tert-butyl N-methylcarbamate;1-(3-fluoropyrrolidin-1-yl)but-2-yn-1-one (PubChem CID 178118680) has the molecular formula C14H23FN2O3
and a molecular weight of 286.35 g/mol. Its IUPAC name is tert-butyl N-methylcarbamate;1-(3-fluoropyrrolidin-1-yl)but-2-yn-1-one.
Molecular Properties
| Compound Name | tert-butyl N-methylcarbamate;1-(3-fluoropyrrolidin-1-yl)but-2-yn-1-one |
| PubChem CID | 178118680 |
| Molecular Formula | C14H23FN2O3 |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | tert-butyl N-methylcarbamate;1-(3-fluoropyrrolidin-1-yl)but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CCC(F)C1.CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C8H10FNO.C6H13NO2/c1-2-3-8(11)10-5-4-7(9)6-10;1-6(2,3)9-5(8)7-4/h7H,4-6H2,1H3;1-4H3,(H,7,8) |
| InChIKey | BBHHETGKNNGXMA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-methylcarbamate;1-(3-fluoropyrrolidin-1-yl)but-2-yn-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-methylcarbamate;1-(3-fluoropyrrolidin-1-yl)but-2-yn-1-one?
The IUPAC name of tert-butyl N-methylcarbamate;1-(3-fluoropyrrolidin-1-yl)but-2-yn-1-one (CID 178118680) is tert-butyl N-methylcarbamate;1-(3-fluoropyrrolidin-1-yl)but-2-yn-1-one.
What is the SMILES notation for tert-butyl N-methylcarbamate;1-(3-fluoropyrrolidin-1-yl)but-2-yn-1-one?
The canonical SMILES for tert-butyl N-methylcarbamate;1-(3-fluoropyrrolidin-1-yl)but-2-yn-1-one is CC#CC(=O)N1CCC(F)C1.CNC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-methylcarbamate;1-(3-fluoropyrrolidin-1-yl)but-2-yn-1-one?
The InChIKey is BBHHETGKNNGXMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FNO.C6H13NO2/c1-2-3-8(11)10-5-4-7(9)6-10;1-6(2,3)9-5(8)7-4/h7H,4-6H2,1H3;1-4H3,(H,7,8).
What are the key properties of tert-butyl N-methylcarbamate;1-(3-fluoropyrrolidin-1-yl)but-2-yn-1-one?
tert-butyl N-methylcarbamate;1-(3-fluoropyrrolidin-1-yl)but-2-yn-1-one has a molecular weight of 286.35 g/mol, XLogP of 1.72, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-methylcarbamate;1-(3-fluoropyrrolidin-1-yl)but-2-yn-1-one is sourced from PubChem (CID 178118680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).