About [(2-methylpropan-2-yl)oxycarbonylamino] azepane-1-carboxylate
[(2-methylpropan-2-yl)oxycarbonylamino] azepane-1-carboxylate (PubChem CID 175316788) has the molecular formula C12H22N2O4
and a molecular weight of 258.32 g/mol. Its IUPAC name is [(2-methylpropan-2-yl)oxycarbonylamino] azepane-1-carboxylate.
Molecular Properties
| Compound Name | [(2-methylpropan-2-yl)oxycarbonylamino] azepane-1-carboxylate |
| PubChem CID | 175316788 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | [(2-methylpropan-2-yl)oxycarbonylamino] azepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)NOC(=O)N1CCCCCC1 |
| InChI | InChI=1S/C12H22N2O4/c1-12(2,3)17-10(15)13-18-11(16)14-8-6-4-5-7-9-14/h4-9H2,1-3H3,(H,13,15) |
| InChIKey | VHQSQJUNNAVALA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2-methylpropan-2-yl)oxycarbonylamino] azepane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2-methylpropan-2-yl)oxycarbonylamino] azepane-1-carboxylate?
The IUPAC name of [(2-methylpropan-2-yl)oxycarbonylamino] azepane-1-carboxylate (CID 175316788) is [(2-methylpropan-2-yl)oxycarbonylamino] azepane-1-carboxylate.
What is the SMILES notation for [(2-methylpropan-2-yl)oxycarbonylamino] azepane-1-carboxylate?
The canonical SMILES for [(2-methylpropan-2-yl)oxycarbonylamino] azepane-1-carboxylate is CC(C)(C)OC(=O)NOC(=O)N1CCCCCC1.
What is the InChIKey of [(2-methylpropan-2-yl)oxycarbonylamino] azepane-1-carboxylate?
The InChIKey is VHQSQJUNNAVALA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O4/c1-12(2,3)17-10(15)13-18-11(16)14-8-6-4-5-7-9-14/h4-9H2,1-3H3,(H,13,15).
What are the key properties of [(2-methylpropan-2-yl)oxycarbonylamino] azepane-1-carboxylate?
[(2-methylpropan-2-yl)oxycarbonylamino] azepane-1-carboxylate has a molecular weight of 258.32 g/mol, XLogP of 2.44, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2-methylpropan-2-yl)oxycarbonylamino] azepane-1-carboxylate is sourced from PubChem (CID 175316788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).