C16H31N3O3 — CID 178119946
tert-butyl N-methylcarbamate;(E)-4-(dimethylamino)-1-pyrrolidin-1-ylbut-2-en-1-one (PubChem CID 178119946) has the molecular formula C16H31N3O3 and a molecular weight of 313.44 g/mol. Its IUPAC name is tert-butyl N-methylcarbamate;(E)-4-(dimethylamino)-1-pyrrolidin-1-ylbut-2-en-1-one.
| Compound Name | tert-butyl N-methylcarbamate;(E)-4-(dimethylamino)-1-pyrrolidin-1-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 178119946 |
| Molecular Formula | C16H31N3O3 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | tert-butyl N-methylcarbamate;(E)-4-(dimethylamino)-1-pyrrolidin-1-ylbut-2-en-1-one |
| SMILES | CN(C)C/C=C/C(=O)N1CCCC1.CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H18N2O.C6H13NO2/c1-11(2)7-5-6-10(13)12-8-3-4-9-12;1-6(2,3)9-5(8)7-4/h5-6H,3-4,7-9H2,1-2H3;1-4H3,(H,7,8)/b6-5+; |
| InChIKey | VXTYXCNHIGSFHV-IPZCTEOASA-N |
| XLogP | 1.87 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|