C11H20N2 — CID 142593526
(2E)-N,N-dimethyl-4-pyrrolidin-1-ylpenta-2,4-dien-1-amine (PubChem CID 142593526) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is (2E)-N,N-dimethyl-4-pyrrolidin-1-ylpenta-2,4-dien-1-amine.
| Compound Name | (2E)-N,N-dimethyl-4-pyrrolidin-1-ylpenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142593526 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (2E)-N,N-dimethyl-4-pyrrolidin-1-ylpenta-2,4-dien-1-amine |
| SMILES | C=C(/C=C/CN(C)C)N1CCCC1 |
| InChI | InChI=1S/C11H20N2/c1-11(7-6-8-12(2)3)13-9-4-5-10-13/h6-7H,1,4-5,8-10H2,2-3H3/b7-6+ |
| InChIKey | CTNKXWPLEPVFSV-VOTSOKGWSA-N |
| XLogP | 1.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|