C11H22NP — CID 174293606
(2E)-N,N-dimethyl-4-[methyl(propan-2-yl)phosphanyl]penta-2,4-dien-1-amine (PubChem CID 174293606) has the molecular formula C11H22NP and a molecular weight of 199.28 g/mol. Its IUPAC name is (2E)-N,N-dimethyl-4-[methyl(propan-2-yl)phosphanyl]penta-2,4-dien-1-amine.
| Compound Name | (2E)-N,N-dimethyl-4-[methyl(propan-2-yl)phosphanyl]penta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 174293606 |
| Molecular Formula | C11H22NP |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.15 |
| IUPAC Name | (2E)-N,N-dimethyl-4-[methyl(propan-2-yl)phosphanyl]penta-2,4-dien-1-amine |
| SMILES | C=C(/C=C/CN(C)C)P(C)C(C)C |
| InChI | InChI=1S/C11H22NP/c1-10(2)13(6)11(3)8-7-9-12(4)5/h7-8,10H,3,9H2,1-2,4-6H3/b8-7+ |
| InChIKey | ADAKZHVZSIOBSJ-BQYQJAHWSA-N |
| XLogP | 3.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|