C14H28N2 — CID 138664657
(Z)-1-N,1-N,5-N,5-N-tetramethyl-4-propylidenehept-2-ene-1,5-diamine (PubChem CID 138664657) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is (Z)-1-N,1-N,5-N,5-N-tetramethyl-4-propylidenehept-2-ene-1,5-diamine.
| Compound Name | (Z)-1-N,1-N,5-N,5-N-tetramethyl-4-propylidenehept-2-ene-1,5-diamine |
|---|---|
| PubChem CID | 138664657 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | (Z)-1-N,1-N,5-N,5-N-tetramethyl-4-propylidenehept-2-ene-1,5-diamine |
| SMILES | CCC=C(/C=C\CN(C)C)C(CC)N(C)C |
| InChI | InChI=1S/C14H28N2/c1-7-10-13(11-9-12-15(3)4)14(8-2)16(5)6/h9-11,14H,7-8,12H2,1-6H3/b11-9-,13-10? |
| InChIKey | UCWVRVOBNCBTCA-NZGLNZLNSA-N |
| XLogP | 2.78 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|