C13H21F — CID 143081217
(5Z)-4-ethyl-5-[(Z)-3-fluoroprop-1-enyl]octa-1,5-diene (PubChem CID 143081217) has the molecular formula C13H21F and a molecular weight of 196.31 g/mol. Its IUPAC name is (5Z)-4-ethyl-5-[(Z)-3-fluoroprop-1-enyl]octa-1,5-diene.
| Compound Name | (5Z)-4-ethyl-5-[(Z)-3-fluoroprop-1-enyl]octa-1,5-diene |
|---|---|
| PubChem CID | 143081217 |
| Molecular Formula | C13H21F |
| Molecular Weight | 196.31 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | (5Z)-4-ethyl-5-[(Z)-3-fluoroprop-1-enyl]octa-1,5-diene |
| SMILES | C=CCC(CC)C(/C=C\CF)=C/CC |
| InChI | InChI=1S/C13H21F/c1-4-8-12(6-3)13(9-5-2)10-7-11-14/h4,7,9-10,12H,1,5-6,8,11H2,2-3H3/b10-7-,13-9+ |
| InChIKey | SPTVRJBLXIQVGS-JWUMZWSUSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|