C10H17F — CID 143996817
(2Z,4Z)-1-fluoro-4-propylhepta-2,4-diene (PubChem CID 143996817) has the molecular formula C10H17F and a molecular weight of 156.24 g/mol. Its IUPAC name is (2Z,4Z)-1-fluoro-4-propylhepta-2,4-diene.
| Compound Name | (2Z,4Z)-1-fluoro-4-propylhepta-2,4-diene |
|---|---|
| PubChem CID | 143996817 |
| Molecular Formula | C10H17F |
| Molecular Weight | 156.24 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | (2Z,4Z)-1-fluoro-4-propylhepta-2,4-diene |
| SMILES | CC/C=C(\C=C/CF)CCC |
| InChI | InChI=1S/C10H17F/c1-3-6-10(7-4-2)8-5-9-11/h5-6,8H,3-4,7,9H2,1-2H3/b8-5-,10-6- |
| InChIKey | GXFFGHQPOHQXRM-UQZKWGPRSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.24 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|