C14H26 — CID 123964701
(3E,5Z)-6-ethyl-4-propylnona-3,5-diene (PubChem CID 123964701) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is (3E,5Z)-6-ethyl-4-propylnona-3,5-diene.
| Compound Name | (3E,5Z)-6-ethyl-4-propylnona-3,5-diene |
|---|---|
| PubChem CID | 123964701 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | (3E,5Z)-6-ethyl-4-propylnona-3,5-diene |
| SMILES | CC/C=C(/C=C(/CC)CCC)CCC |
| InChI | InChI=1S/C14H26/c1-5-9-13(8-4)12-14(10-6-2)11-7-3/h10,12H,5-9,11H2,1-4H3/b13-12-,14-10+ |
| InChIKey | HLLFMTIWMGTSER-DWSOYORSSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|