C12H22 — CID 5368963
(3E,5E)-4,5-diethylocta-3,5-diene (PubChem CID 5368963) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is (3E,5E)-4,5-diethylocta-3,5-diene.
| Compound Name | (3E,5E)-4,5-diethylocta-3,5-diene |
|---|---|
| PubChem CID | 5368963 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | (3E,5E)-4,5-diethylocta-3,5-diene |
| SMILES | CC/C=C(CC)/C(=C/CC)CC |
| InChI | InChI=1S/C12H22/c1-5-9-11(7-3)12(8-4)10-6-2/h9-10H,5-8H2,1-4H3/b11-9+,12-10+ |
| InChIKey | KICBULPPWKMVQH-WGDLNXRISA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|