About (3E,5E)-4,5-diethylocta-3,5-diene
(3E,5E)-4,5-diethylocta-3,5-diene (PubChem CID 5368963) has the molecular formula C12H22
and a molecular weight of 166.31 g/mol. Its IUPAC name is (3E,5E)-4,5-diethylocta-3,5-diene.
Molecular Properties
| Compound Name | (3E,5E)-4,5-diethylocta-3,5-diene |
| PubChem CID | 5368963 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | (3E,5E)-4,5-diethylocta-3,5-diene |
| SMILES | CC/C=C(CC)/C(=C/CC)CC |
| InChI | InChI=1S/C12H22/c1-5-9-11(7-3)12(8-4)10-6-2/h9-10H,5-8H2,1-4H3/b11-9+,12-10+ |
| InChIKey | KICBULPPWKMVQH-WGDLNXRISA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,5E)-4,5-diethylocta-3,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5E)-4,5-diethylocta-3,5-diene?
The IUPAC name of (3E,5E)-4,5-diethylocta-3,5-diene (CID 5368963) is (3E,5E)-4,5-diethylocta-3,5-diene.
What is the SMILES notation for (3E,5E)-4,5-diethylocta-3,5-diene?
The canonical SMILES for (3E,5E)-4,5-diethylocta-3,5-diene is CC/C=C(CC)/C(=C/CC)CC.
What is the InChIKey of (3E,5E)-4,5-diethylocta-3,5-diene?
The InChIKey is KICBULPPWKMVQH-WGDLNXRISA-N. The full InChI is InChI=1S/C12H22/c1-5-9-11(7-3)12(8-4)10-6-2/h9-10H,5-8H2,1-4H3/b11-9+,12-10+.
What are the key properties of (3E,5E)-4,5-diethylocta-3,5-diene?
(3E,5E)-4,5-diethylocta-3,5-diene has a molecular weight of 166.31 g/mol, XLogP of 4.48, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5E)-4,5-diethylocta-3,5-diene is sourced from PubChem (CID 5368963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).