C12H21I — CID 15329333
(3Z,5E)-4,5-diethyl-3-iodoocta-3,5-diene (PubChem CID 15329333) has the molecular formula C12H21I and a molecular weight of 292.20 g/mol. Its IUPAC name is (3Z,5E)-4,5-diethyl-3-iodoocta-3,5-diene.
| Compound Name | (3Z,5E)-4,5-diethyl-3-iodoocta-3,5-diene |
|---|---|
| PubChem CID | 15329333 |
| Molecular Formula | C12H21I |
| Molecular Weight | 292.20 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | (3Z,5E)-4,5-diethyl-3-iodoocta-3,5-diene |
| SMILES | CC/C=C(CC)/C(CC)=C(\I)CC |
| InChI | InChI=1S/C12H21I/c1-5-9-10(6-2)11(7-3)12(13)8-4/h9H,5-8H2,1-4H3/b10-9+,12-11- |
| InChIKey | AATQCHYUBOFPNI-PVHUKWJHSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.20 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|