C9H15Br — CID 178143445
(2Z,4E)-4-bromo-3-ethylhepta-2,4-diene (PubChem CID 178143445) has the molecular formula C9H15Br and a molecular weight of 203.12 g/mol. Its IUPAC name is (2Z,4E)-4-bromo-3-ethylhepta-2,4-diene.
| Compound Name | (2Z,4E)-4-bromo-3-ethylhepta-2,4-diene |
|---|---|
| PubChem CID | 178143445 |
| Molecular Formula | C9H15Br |
| Molecular Weight | 203.12 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | (2Z,4E)-4-bromo-3-ethylhepta-2,4-diene |
| SMILES | C/C=C(CC)\C(Br)=C/CC |
| InChI | InChI=1S/C9H15Br/c1-4-7-9(10)8(5-2)6-3/h5,7H,4,6H2,1-3H3/b8-5-,9-7+ |
| InChIKey | FSWDQXOFBKLBQH-ANVCMGODSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.12 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|