C13H28O — CID 143085238
ethane;(Z,2E)-3-ethyl-2-ethylidenepent-3-en-1-ol (PubChem CID 143085238) has the molecular formula C13H28O and a molecular weight of 200.37 g/mol. Its IUPAC name is ethane;(Z,2E)-3-ethyl-2-ethylidenepent-3-en-1-ol.
| Compound Name | ethane;(Z,2E)-3-ethyl-2-ethylidenepent-3-en-1-ol |
|---|---|
| PubChem CID | 143085238 |
| Molecular Formula | C13H28O |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.21 |
| IUPAC Name | ethane;(Z,2E)-3-ethyl-2-ethylidenepent-3-en-1-ol |
| SMILES | C/C=C(CC)\C(=C/C)CO.CC.CC |
| InChI | InChI=1S/C9H16O.2C2H6/c1-4-8(5-2)9(6-3)7-10;2*1-2/h4,6,10H,5,7H2,1-3H3;2*1-2H3/b8-4-,9-6-;; |
| InChIKey | SHOBXMCRZCWRDG-HIASMNCESA-N |
| XLogP | 4.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|