C13H25N — CID 143467837
(2E,4Z)-3,4-diethylhexa-2,4-dien-1-imine;propane (PubChem CID 143467837) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is (2E,4Z)-3,4-diethylhexa-2,4-dien-1-imine;propane.
| Compound Name | (2E,4Z)-3,4-diethylhexa-2,4-dien-1-imine;propane |
|---|---|
| PubChem CID | 143467837 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | (2E,4Z)-3,4-diethylhexa-2,4-dien-1-imine;propane |
| SMILES | CCC.[H]/N=C/C=C(CC)/C(=C\C)CC |
| InChI | InChI=1S/C10H17N.C3H8/c1-4-9(5-2)10(6-3)7-8-11;1-3-2/h4,7-8,11H,5-6H2,1-3H3;3H2,1-2H3/b9-4-,10-7+,11-8+; |
| InChIKey | LJJLTOLXWZLWBR-KTTPABOKSA-N |
| XLogP | 4.74 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|