C11H19N — CID 143747479
(2Z)-3-ethenyl-4-methylpenta-2,4-dien-1-imine;propane (PubChem CID 143747479) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is (2Z)-3-ethenyl-4-methylpenta-2,4-dien-1-imine;propane.
| Compound Name | (2Z)-3-ethenyl-4-methylpenta-2,4-dien-1-imine;propane |
|---|---|
| PubChem CID | 143747479 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (2Z)-3-ethenyl-4-methylpenta-2,4-dien-1-imine;propane |
| SMILES | CCC.[H]/N=C/C=C(/C=C)C(=C)C |
| InChI | InChI=1S/C8H11N.C3H8/c1-4-8(5-6-9)7(2)3;1-3-2/h4-6,9H,1-2H2,3H3;3H2,1-2H3/b8-5-,9-6+; |
| InChIKey | JBCFRLCOLUEWEG-BJHRKZFFSA-N |
| XLogP | 3.74 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|