C12H19N — CID 123911994
5-ethenyl-6-methylnona-4,6-dien-1-imine (PubChem CID 123911994) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 5-ethenyl-6-methylnona-4,6-dien-1-imine.
| Compound Name | 5-ethenyl-6-methylnona-4,6-dien-1-imine |
|---|---|
| PubChem CID | 123911994 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 5-ethenyl-6-methylnona-4,6-dien-1-imine |
| SMILES | [H]/N=C/CCC=C(C=C)C(C)=CCC |
| InChI | InChI=1S/C12H19N/c1-4-8-11(3)12(5-2)9-6-7-10-13/h5,8-10,13H,2,4,6-7H2,1,3H3/b11-8?,12-9?,13-10+ |
| InChIKey | UMUAVHJKRFUMRN-AUHDGBGTSA-N |
| XLogP | 3.88 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|