About 6-methylnon-5-en-1-imine
6-methylnon-5-en-1-imine (PubChem CID 90789693) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is 6-methylnon-5-en-1-imine.
Molecular Properties
| Compound Name | 6-methylnon-5-en-1-imine |
| PubChem CID | 90789693 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | 6-methylnon-5-en-1-imine |
| SMILES | [H]/N=C/CCCC=C(C)CCC |
| InChI | InChI=1S/C10H19N/c1-3-7-10(2)8-5-4-6-9-11/h8-9,11H,3-7H2,1-2H3/b10-8?,11-9+ |
| InChIKey | ZPHBNEJGLAORBM-IZYRKSBPSA-N |
| XLogP | 3.55 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-methylnon-5-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylnon-5-en-1-imine?
The IUPAC name of 6-methylnon-5-en-1-imine (CID 90789693) is 6-methylnon-5-en-1-imine.
What is the SMILES notation for 6-methylnon-5-en-1-imine?
The canonical SMILES for 6-methylnon-5-en-1-imine is [H]/N=C/CCCC=C(C)CCC.
What is the InChIKey of 6-methylnon-5-en-1-imine?
The InChIKey is ZPHBNEJGLAORBM-IZYRKSBPSA-N. The full InChI is InChI=1S/C10H19N/c1-3-7-10(2)8-5-4-6-9-11/h8-9,11H,3-7H2,1-2H3/b10-8?,11-9+.
What are the key properties of 6-methylnon-5-en-1-imine?
6-methylnon-5-en-1-imine has a molecular weight of 153.27 g/mol, XLogP of 3.55, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylnon-5-en-1-imine is sourced from PubChem (CID 90789693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).